EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C)CC[C@H](O)[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O5/c1-10-8-20-9-11(10)4-5-12(20)18(2)7-6-13(21)19(3,17(24)25)15(18)14(20)16(22)23/h11-15,21H,1,4-9H2,2-3H3,(H,22,23)(H,24,25)/t11-,12+,13+,14-,15+,18+,19-,20+/m1/s1 |
| InChIKey | NJEWNTGSXKRWKA-MJPABCAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gibberella fujikuroi (ncbitaxon:5127) | - | PubMed (24232845) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A14 (CHEBI:29588) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A14 (CHEBI:29588) is a dicarboxylic acid (CHEBI:35692) |
| gibberellin A14 (CHEBI:29588) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A14 (CHEBI:29588) is conjugate acid of gibberellin A14(2−) (CHEBI:143961) |
| Incoming Relation(s) |
| gibberellin A14 aldehyde (CHEBI:29589) has functional parent gibberellin A14 (CHEBI:29588) |
| gibberellin A14(2−) (CHEBI:143961) is conjugate base of gibberellin A14 (CHEBI:29588) |
| IUPAC Names |
|---|
| (1R,2S,3S,4S,5S,8S,9S,12R)-5-hydroxy-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| 2β-hydroxy-1β,4a-dimethyl-8-methylidene-4aα,4bβ-gibbane-1α,10β-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| ent-3α-hydroxygibberell-16-ene-7,9-dioic acid | ChEBI |
| GA14 | ChEBI |
| gibberellin 14 | ChEBI |
| Gibberellin A14 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000014 | KNApSAcK |
| C11858 | KEGG COMPOUND |
| LMPR0104170015 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2953727 | Reaxys |
| CAS:429678-85-3 | KEGG COMPOUND |
| CAS:4955-22-0 | KEGG COMPOUND |
| Citations |
|---|