EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C7H7NO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,8H2,(H,10,11) |
| InChIKey | MRBKRZAPGUCWOS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-4-hydroxybenzoic acid (CHEBI:29476) is a aminobenzoic acid (CHEBI:22495) |
| 3-amino-4-hydroxybenzoic acid (CHEBI:29476) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-amino-4-hydroxybenzoic acid (CHEBI:29476) is conjugate acid of 3-amino-4-hydroxybenzoate (CHEBI:60005) |
| Incoming Relation(s) |
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid (CHEBI:142394) has functional parent 3-amino-4-hydroxybenzoic acid (CHEBI:29476) |
| 3-acetamido-4-hydroxybenzoic acid (CHEBI:140603) has functional parent 3-amino-4-hydroxybenzoic acid (CHEBI:29476) |
| 3-amino-4-hydroxybenzoate (CHEBI:60005) is conjugate base of 3-amino-4-hydroxybenzoic acid (CHEBI:29476) |
| Synonyms | Source |
|---|---|
| 3,4-AHBA | KEGG COMPOUND |
| 3-amino-4-hydroxybenzoic acid | ChEBI |