EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O3 |
| Net Charge | 0 |
| Average Mass | 210.233 |
| Monoisotopic Mass | 210.10044 |
| SMILES | NCCCNc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C10H14N2O3/c11-4-1-5-12-8-6-7(10(14)15)2-3-9(8)13/h2-3,6,12-13H,1,4-5,11H2,(H,14,15) |
| InChIKey | WASZXVMLVDQNDE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acinetobacter baylyi ADP1 (ncbitaxon:62977) | - | Article (15514110 ) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid (CHEBI:142394) has functional parent 3-amino-4-hydroxybenzoic acid (CHEBI:29476) |
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid (CHEBI:142394) has role bacterial metabolite (CHEBI:76969) |
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid (CHEBI:142394) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid (CHEBI:142394) is a primary amino compound (CHEBI:50994) |
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid (CHEBI:142394) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 3-[(3-aminopropyl)amino]-4-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| APAH | SUBMITTER |
| 3-((3-aminopropyl)amino)-4-hydroxybenzoic acid | ChEBI |
| Citations |
|---|