EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2.2C4H4O4 |
| Net Charge | 0 |
| Average Mass | 522.554 |
| Monoisotopic Mass | 522.20022 |
| SMILES | CN1CCC(=C2c3ccccc3CCc3cccnc32)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H22N2.2C4H4O4/c1-22-13-10-16(11-14-22)19-18-7-3-2-5-15(18)8-9-17-6-4-12-21-20(17)19;2*5-3(6)1-2-4(7)8/h2-7,12H,8-11,13-14H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | SGHXFFAHXTZRQM-SPIKMXEPSA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azatadine maleate (CHEBI:2947) has part azatadine (CHEBI:2946) |
| azatadine maleate (CHEBI:2947) has role anti-allergic agent (CHEBI:50857) |
| azatadine maleate (CHEBI:2947) has role H1-receptor antagonist (CHEBI:37955) |
| azatadine maleate (CHEBI:2947) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 11-(1-methylpiperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2- b]pyridine di[(2Z)-but-2-enedioate] |
| Synonyms | Source |
|---|---|
| 6,11-Dihydro-11-(1-methyl-4-piperidylidene)5H-benzo(5,6)cyclohepta(1,2-b)pyridine dimaleate | ChemIDplus |
| Azatadine dimaleate | ChemIDplus |