EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2 |
| Net Charge | 0 |
| Average Mass | 290.410 |
| Monoisotopic Mass | 290.17830 |
| SMILES | CN1CCC(=C2c3ccccc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C20H22N2/c1-22-13-10-16(11-14-22)19-18-7-3-2-5-15(18)8-9-17-6-4-12-21-20(17)19/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | SEBMTIQKRHYNIT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azatadine (CHEBI:2946) has role anti-allergic agent (CHEBI:50857) |
| azatadine (CHEBI:2946) has role H1-receptor antagonist (CHEBI:37955) |
| azatadine (CHEBI:2946) is a benzocycloheptapyridine (CHEBI:48593) |
| azatadine (CHEBI:2946) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| azatadine maleate (CHEBI:2947) has part azatadine (CHEBI:2946) |
| IUPAC Name |
|---|
| 11-(1-methylpiperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
| INNs | Source |
|---|---|
| azatadine | KEGG DRUG |
| azatadina | DrugBank |
| azatadinum | DrugBank |
| Synonyms | Source |
|---|---|
| 6,11-Dihydro-11-(1-methyl-4-piperidylidene)-5H-benzo(5,6)cyclohepta(1,2-b)pyridine | ChemIDplus |
| 11-(1-Methyl-4-piperidinylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine | NIST Chemistry WebBook |