EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)=CCC/C(C)=C\CO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
| InChIKey | GLZPCOQZEFWAFX-YFHOEESVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nerol (CHEBI:29452) has role fragrance (CHEBI:48318) |
| nerol (CHEBI:29452) has role plant metabolite (CHEBI:76924) |
| nerol (CHEBI:29452) has role volatile oil component (CHEBI:27311) |
| nerol (CHEBI:29452) is a 3,7-dimethylocta-2,6-dien-1-ol (CHEBI:24221) |
| Incoming Relation(s) |
| nerol oxide (CHEBI:144705) has functional parent nerol (CHEBI:29452) |
| neryl acetate (CHEBI:141210) has functional parent nerol (CHEBI:29452) |
| IUPAC Name |
|---|
| (2Z)-3,7-dimethylocta-2,6-dien-1-ol |
| Synonyms | Source |
|---|---|
| 2-cis-3,7-dimethyl-2,6-octadien-1-ol | ChemIDplus |
| (2Z)-3,7-dimethyl-2,6-octadien-1-ol | NIST Chemistry WebBook |
| cis-3,7-dimethyl-2,6-octadien-1-ol | NIST Chemistry WebBook |
| cis-geraniol | ChEBI |
| (Z)-3,7-dimethyl-2,6-octadien-1-ol | ChemIDplus |
| (Z)-geraniol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| nerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000855 | KNApSAcK |
| C09871 | KEGG COMPOUND |
| CN103342627 | Patent |
| CPD-7978 | MetaCyc |
| LMPR0102010010 | LIPID MAPS |
| MX2013000640 | Patent |
| Nerol | Wikipedia |
| Citations |
|---|