EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=CC1CC(C)=CCO1 |
| InChI | InChI=1S/C10H16O/c1-8(2)6-10-7-9(3)4-5-11-10/h4,6,10H,5,7H2,1-3H3 |
| InChIKey | FRISMOQHTLZZRP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euroleon nostras (ncbitaxon:516507) | gland (BTO:0000522) | PubMed (24271427) | Detected in the thoracic gland. |
| Vitis vinifera (ncbitaxon:29760) | |||
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Italia | |
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Zaomeiguixiang | |
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Xiangfei |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nerol oxide (CHEBI:144705) has functional parent nerol (CHEBI:29452) |
| nerol oxide (CHEBI:144705) has role animal metabolite (CHEBI:75767) |
| nerol oxide (CHEBI:144705) has role flavouring agent (CHEBI:35617) |
| nerol oxide (CHEBI:144705) has role plant metabolite (CHEBI:76924) |
| nerol oxide (CHEBI:144705) is a monoterpenoid (CHEBI:25409) |
| nerol oxide (CHEBI:144705) is a olefinic compound (CHEBI:78840) |
| nerol oxide (CHEBI:144705) is a pyrans (CHEBI:26407) |
| IUPAC Name |
|---|
| 4-methyl-2-(2-methylprop-1-en-1-yl)-3,6-dihydro-2H-pyran |
| Synonyms | Source |
|---|---|
| 3,6-dihydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran | ChemIDplus |
| 3,6-dihydro-4-methyl-2-(2-methylpropen-1-yl)-2H-pyran | ChemIDplus |
| 3,6-dihydro-4-methyl-2-(2-methylpropenyl)-2H-pyran | ChemIDplus |
| 4-methyl-2-(2-methyl-1-propen-1-yl)-3,6-dihydro-2H-pyran | ChEBI |
| 4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-pyran | ChEBI |
| neryl oxide | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| FDB020082 | FooDB |
| HMDB0038557 | HMDB |
| Citations |
|---|