EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HAsO3 |
| Net Charge | -2 |
| Average Mass | 123.927 |
| Monoisotopic Mass | 123.91526 |
| SMILES | [O-][As]([O-])O |
| InChI | InChI=1S/AsHO3/c2-1(3)4/h2H/q-2 |
| InChIKey | RJFGWSIMCQVVJS-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsenite(2−) (CHEBI:29243) is a arsenite ion (CHEBI:22633) |
| arsenite(2−) (CHEBI:29243) is a divalent inorganic anion (CHEBI:79388) |
| arsenite(2−) (CHEBI:29243) is conjugate acid of arsenite(3−) (CHEBI:29866) |
| arsenite(2−) (CHEBI:29243) is conjugate base of arsenite(1−) (CHEBI:29242) |
| Incoming Relation(s) |
| arsenite(1−) (CHEBI:29242) is conjugate acid of arsenite(2−) (CHEBI:29243) |
| arsenite(3−) (CHEBI:29866) is conjugate base of arsenite(2−) (CHEBI:29243) |
| IUPAC Name |
|---|
| hydroxidodioxidoarsenate(2−) |
| Synonyms | Source |
|---|---|
| [AsO2(OH)]2− | IUPAC |
| hydrogen arsenite | IUPAC |
| HAsO32− | ChEBI |