EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2AsO3 |
| Net Charge | -1 |
| Average Mass | 124.935 |
| Monoisotopic Mass | 124.92254 |
| SMILES | [O-][As](O)O |
| InChI | InChI=1S/AsH2O3/c2-1(3)4/h2-3H/q-1 |
| InChIKey | AQLMHYSWFMLWBS-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsenite(1−) (CHEBI:29242) is a arsenite ion (CHEBI:22633) |
| arsenite(1−) (CHEBI:29242) is a monovalent inorganic anion (CHEBI:79389) |
| arsenite(1−) (CHEBI:29242) is conjugate acid of arsenite(2−) (CHEBI:29243) |
| arsenite(1−) (CHEBI:29242) is conjugate base of arsenous acid (CHEBI:49900) |
| Incoming Relation(s) |
| arsenous acid (CHEBI:49900) is conjugate acid of arsenite(1−) (CHEBI:29242) |
| arsenite(2−) (CHEBI:29243) is conjugate base of arsenite(1−) (CHEBI:29242) |
| IUPAC Name |
|---|
| dihydroxidooxidoarsenate(1−) |
| Synonyms | Source |
|---|---|
| [AsO(OH)2]− | IUPAC |
| dihydrogen arsenite | IUPAC |
| H2AsO3− | ChEBI |
| UniProt Name | Source |
|---|---|
| arsenite | UniProt |