EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H72N2O12.2C6H5O3S |
| Net Charge | 0 |
| Average Mass | 1243.501 |
| Monoisotopic Mass | 1242.50041 |
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3CC[N+]2(C)CCC(=O)OCCCCCOC(=O)CC[N+]2(C)CCc3cc(OC)c(OC)cc3C2Cc2ccc(OC)c(OC)c2)cc1OC.O=S(=O)([O-])c1ccccc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C53H72N2O12.2C6H6O3S/c1-54(22-18-38-32-48(62-7)50(64-9)34-40(38)42(54)28-36-14-16-44(58-3)46(30-36)60-5)24-20-52(56)66-26-12-11-13-27-67-53(57)21-25-55(2)23-19-39-33-49(63-8)51(65-10)35-41(39)43(55)29-37-15-17-45(59-4)47(31-37)61-6;2*7-10(8,9)6-4-2-1-3-5-6/h14-17,30-35,42-43H,11-13,18-29H2,1-10H3;2*1-5H,(H,7,8,9)/q+2;;/p-2 |
| InChIKey | XXZSQOVSEBAPGS-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atracurium besylate (CHEBI:2915) has part atracurium (CHEBI:2914) |
| atracurium besylate (CHEBI:2915) has role muscle relaxant (CHEBI:51371) |
| atracurium besylate (CHEBI:2915) has role nicotinic antagonist (CHEBI:48878) |
| atracurium besylate (CHEBI:2915) is a organosulfonate salt (CHEBI:64382) |
| atracurium besylate (CHEBI:2915) is a quaternary ammonium salt (CHEBI:35273) |
| Incoming Relation(s) |
| cisatracurium besylate (CHEBI:3721) is a atracurium besylate (CHEBI:2915) |
| IUPAC Name |
|---|
| 2,2'-{pentane-1,5-diylbis[oxy(3-oxopropane-3,1-diyl)]}bis[1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium] bisbenzenesulfonate |
| INNs | Source |
|---|---|
| atracurii besilas | ChemIDplus |
| atracurium besilate | KEGG DRUG |
| besilate d'atracurium | ChemIDplus |
| besilato de atracurio | ChemIDplus |
| Synonyms | Source |
|---|---|
| Atracurium dibesylate | ChEMBL |
| BW 33A | ChEMBL |
| BW-33A | ChEMBL |
| NSC-760047 | ChEMBL |
| WELLCOME 33-A-74 | ChEMBL |
| Brand Names | Source |
|---|---|
| Atracurium besylate preservative free | ChEMBL |
| Tracrium preservative free | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3535417 | Beilstein |
| CAS:64228-81-5 | KEGG DRUG |
| CAS:64228-81-5 | ChemIDplus |
| Citations |
|---|