EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=CCC/C(C)=C\C=O |
| InChI | InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7- |
| InChIKey | WTEVQBCEXWBHNA-YFHOEESVSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neral (CHEBI:29020) has role apoptosis inducer (CHEBI:68495) |
| neral (CHEBI:29020) has role plant metabolite (CHEBI:76924) |
| neral (CHEBI:29020) is a enal (CHEBI:51688) |
| neral (CHEBI:29020) is a monoterpenoid (CHEBI:25409) |
| Incoming Relation(s) |
| citral (CHEBI:23316) has part neral (CHEBI:29020) |
| IUPAC Name |
|---|
| (2Z)-3,7-dimethylocta-2,6-dienal |
| Synonyms | Source |
|---|---|
| cis-Citral | KEGG COMPOUND |
| Neral | KEGG COMPOUND |
| cis-citral | ChEBI |
| citral B | ChEBI |
| Lemonal | HMDB |
| UniProt Name | Source |
|---|---|
| neral | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09847 | KEGG COMPOUND |
| LMPR0102010006 | LIPID MAPS |
| CPD-9762 | MetaCyc |
| HMDB0035092 | HMDB |
| C00003036 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721872 | Reaxys |
| CAS:106-26-3 | KEGG COMPOUND |
| CAS:106-26-3 | ChemIDplus |
| Citations |
|---|