EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=CCCC(C)=CC=O |
| InChI | InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | WTEVQBCEXWBHNA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.2.3.1 (aldehyde oxidase) inhibitor An EC 1.2.3.* (oxidoreductase acting on donor aldehyde/oxo group with oxygen as acceptor) inhibitor which interferes with the action of aldehyde oxidase (EC 1.2.3.1). |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citral (CHEBI:23316) has part geranial (CHEBI:16980) |
| citral (CHEBI:23316) has part neral (CHEBI:29020) |
| citral (CHEBI:23316) has role EC 1.2.3.1 (aldehyde oxidase) inhibitor (CHEBI:62872) |
| citral (CHEBI:23316) has role flavouring agent (CHEBI:35617) |
| citral (CHEBI:23316) has role fragrance (CHEBI:48318) |
| citral (CHEBI:23316) has role insecticide (CHEBI:24852) |
| citral (CHEBI:23316) has role metabolite (CHEBI:25212) |
| citral (CHEBI:23316) is a mixture (CHEBI:60004) |
| Incoming Relation(s) |
| citral dimethyl acetal (CHEBI:132331) has functional parent citral (CHEBI:23316) |
| IUPAC Name |
|---|
| 3,7-dimethylocta-2,6-dienal |
| Synonyms | Source |
|---|---|
| 3,7-dimethyl-2,6-octadienal | ChEBI |
| cis,trans-Citral | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| citral | UniProt |
| Citations |
|---|