EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:23316 - citral
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=CCCC(C)=CC=O |
| InChI | InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | WTEVQBCEXWBHNA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | EC 1.2.3.1 (aldehyde oxidase) inhibitor An EC 1.2.3.* (oxidoreductase acting on donor aldehyde/oxo group with oxygen as acceptor) inhibitor which interferes with the action of aldehyde oxidase (EC 1.2.3.1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citral (CHEBI:23316) has part geranial (CHEBI:16980) |
| citral (CHEBI:23316) has part neral (CHEBI:29020) |
| citral (CHEBI:23316) has role EC 1.2.3.1 (aldehyde oxidase) inhibitor (CHEBI:62872) |
| citral (CHEBI:23316) has role flavouring agent (CHEBI:35617) |
| citral (CHEBI:23316) has role fragrance (CHEBI:48318) |
| citral (CHEBI:23316) has role insecticide (CHEBI:24852) |
| citral (CHEBI:23316) has role metabolite (CHEBI:25212) |
| citral (CHEBI:23316) is a mixture (CHEBI:60004) |
| Incoming Relation(s) |
| citral dimethyl acetal (CHEBI:132331) has functional parent citral (CHEBI:23316) |
| IUPAC Name |
|---|
| 3,7-dimethylocta-2,6-dienal |
| Synonyms | Source |
|---|---|
| 3,7-dimethyl-2,6-octadienal | ChEBI |
| cis,trans-Citral | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| citral | UniProt |
| Citations |
|---|