EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O6 |
| Net Charge | 0 |
| Average Mass | 516.719 |
| Monoisotopic Mass | 516.34509 |
| SMILES | [H][C@@]12[C@H](O)C[C@@]3([H])/C(=C(\CCC=C(C)C)C(=O)O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]1(C)CC[C@@]1([H])[C@H](C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C31H48O6/c1-17(2)9-8-10-20(28(35)36)26-22-15-24(34)27-29(5)13-12-23(33)18(3)21(29)11-14-30(27,6)31(22,7)16-25(26)37-19(4)32/h9,18,21-25,27,33-34H,8,10-16H2,1-7H3,(H,35,36)/b26-20-/t18-,21-,22-,23+,24+,25-,27-,29-,30-,31-/m0/s1 |
| InChIKey | IECPWNUMDGFDKC-MZJAQBGESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. EC 2.7.1.33 (pantothenate kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of pantothenate kinase (EC 2.7.1.33). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusidic acid (CHEBI:29013) has parent hydride 5α-cholestane (CHEBI:35515) |
| fusidic acid (CHEBI:29013) has role Escherichia coli metabolite (CHEBI:76971) |
| fusidic acid (CHEBI:29013) has role antibacterial agent (CHEBI:33282) |
| fusidic acid (CHEBI:29013) has role antiinfective agent (CHEBI:35441) |
| fusidic acid (CHEBI:29013) has role antineoplastic agent (CHEBI:35610) |
| fusidic acid (CHEBI:29013) has role EC 2.7.1.33 (pantothenate kinase) inhibitor (CHEBI:77194) |
| fusidic acid (CHEBI:29013) has role ophthalmology drug (CHEBI:66981) |
| fusidic acid (CHEBI:29013) has role protein synthesis inhibitor (CHEBI:48001) |
| fusidic acid (CHEBI:29013) is a 11α-hydroxy steroid (CHEBI:19129) |
| fusidic acid (CHEBI:29013) is a 3α-hydroxy steroid (CHEBI:36835) |
| fusidic acid (CHEBI:29013) is a organic molecular entity (CHEBI:50860) |
| fusidic acid (CHEBI:29013) is a steroid acid (CHEBI:47891) |
| fusidic acid (CHEBI:29013) is a steroid antibiotic (CHEBI:26761) |
| fusidic acid (CHEBI:29013) is a steroid ester (CHEBI:47880) |
| fusidic acid (CHEBI:29013) is a sterol ester (CHEBI:35915) |
| fusidic acid (CHEBI:29013) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| fusidic acid (CHEBI:29013) is conjugate acid of fusidate (CHEBI:71321) |
| Incoming Relation(s) |
| fusidate (CHEBI:71321) is conjugate base of fusidic acid (CHEBI:29013) |
| IUPAC Name |
|---|
| (2Z)-2-[(17Z)-16β-acetoxy-3α,11α-dihydroxy-4α,8α,10,14β-tetramethyl-5α,9β,13α-gonan-17-ylidene]-6-methylhept-5-enoic acid |
| INNs | Source |
|---|---|
| acide fusidique | WHO MedNet |
| acido fusidico | WHO MedNet |
| Synonyms | Source |
|---|---|
| Anhydrous fusidic acid | ChEMBL |
| CEM-102 | ChEMBL |
| fucidic acid | ChEBI |
| Fucidin acid | ChemIDplus |
| Fusidate | ChEMBL |
| Fusidic acid | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Fucidin caviject | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1261 | DrugCentral |
| 1776 | VSDB |
| C00023903 | KNApSAcK |
| C06694 | KEGG COMPOUND |
| CPD0-1606 | MetaCyc |
| D04281 | KEGG DRUG |
| DB02703 | DrugBank |
| FUA | PDBeChem |
| Fusidic_acid | Wikipedia |
| HMDB0015570 | HMDB |
| LMPR0106040001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2197692 | Reaxys |
| Beilstein:5672885 | Beilstein |
| CAS:6990-06-3 | ChemIDplus |
| Citations |
|---|