EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28901 - busulfan
| Formula | C6H14O6S2 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.02318 |
| SMILES | CS(=O)(=O)OCCCCOS(C)(=O)=O |
| InChI | InChI=1S/C6H14O6S2/c1-13(7,8)11-5-3-4-6-12-14(2,9)10/h3-6H2,1-2H3 |
| InChIKey | COVZYZSDYWQREU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. insect sterilant A chemosterilant intended to sterilize insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| busulfan (CHEBI:28901) has functional parent butane-1,4-diol (CHEBI:41189) |
| busulfan (CHEBI:28901) has role alkylating agent (CHEBI:22333) |
| busulfan (CHEBI:28901) has role antineoplastic agent (CHEBI:35610) |
| busulfan (CHEBI:28901) has role carcinogenic agent (CHEBI:50903) |
| busulfan (CHEBI:28901) has role insect sterilant (CHEBI:67105) |
| busulfan (CHEBI:28901) has role teratogenic agent (CHEBI:50905) |
| busulfan (CHEBI:28901) is a methanesulfonate ester (CHEBI:25223) |
| IUPAC Name |
|---|
| butane-1,4-diyl dimethanesulfonate |
| INNs | Source |
|---|---|
| busulfan | WHO MedNet |
| busulfan | WHO MedNet |
| busulfano | WHO MedNet |
| busulfanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Busulfan | KEGG DRUG |
| 1,4-Butanediol dimethanesulfonate | ChemIDplus |
| 1,4-Dimethanesulfonoxybutane | ChemIDplus |
| 1,4-Bis(methanesulfonoxy)butane | ChemIDplus |
| 1,4-Dimesyloxybutane | ChemIDplus |
| Tetramethylene bis(methanesulfonate) | ChemIDplus |
| Brand Names | Source |
|---|---|
| Myleran | KEGG DRUG |
| Bisulfex | ChEBI |
| Mablin | ChEBI |
| Mielucin | ChEBI |
| Mitostan | ChEBI |
| Myeloleukon | ChEBI |
| Citations |
|---|