EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8O2 |
| Net Charge | 0 |
| Average Mass | 184.194 |
| Monoisotopic Mass | 184.05243 |
| SMILES | c1ccc2c(c1)Oc1ccccc1O2 |
| InChI | InChI=1S/C12H8O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H |
| InChIKey | NFBOHOGPQUYFRF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxanthrene (CHEBI:28891) is a dibenzodioxine (CHEBI:23825) |
| oxanthrene (CHEBI:28891) is a heteranthrene (CHEBI:36680) |
| oxanthrene (CHEBI:28891) is a mancude organic heterotricyclic parent (CHEBI:36416) |
| oxanthrene (CHEBI:28891) is a oxacycle (CHEBI:38104) |
| oxanthrene (CHEBI:28891) is a polycyclic heteroarene (CHEBI:38180) |
| IUPAC Name |
|---|
| oxanthrene |
| Synonyms | Source |
|---|---|
| dibenzo[1,4]dioxin | NIST Chemistry WebBook |
| dibenzo[1,4]dioxine | IUPAC |
| dibenzodioxin | ChemIDplus |
| dibenzo[b,e][1,4]dioxin | NIST Chemistry WebBook |
| dibenzo[b,e][1,4]dioxine | IUPAC |
| Dibenzo-p-dioxin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| dibenzo-p-dioxin | UniProt |