EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28854 - 2,4-D
| Formula | C8H6Cl2O3 |
| Net Charge | 0 |
| Average Mass | 221.039 |
| Monoisotopic Mass | 219.96940 |
| SMILES | O=C(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | OVSKIKFHRZPJSS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | synthetic auxin A synthetic compound exhibiting auxin activity. EC 1.1.1.25 (shikimate dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of shikimate dehydrogenase (EC 1.1.1.25). |
| Applications: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. defoliant A herbicide which when sprayed or dusted on plants causes its leaves to fall off. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-D (CHEBI:28854) has role agrochemical (CHEBI:33286) |
| 2,4-D (CHEBI:28854) has role defoliant (CHEBI:23582) |
| 2,4-D (CHEBI:28854) has role EC 1.1.1.25 (shikimate dehydrogenase) inhibitor (CHEBI:77484) |
| 2,4-D (CHEBI:28854) has role environmental contaminant (CHEBI:78298) |
| 2,4-D (CHEBI:28854) has role phenoxy herbicide (CHEBI:60575) |
| 2,4-D (CHEBI:28854) has role synthetic auxin (CHEBI:26841) |
| 2,4-D (CHEBI:28854) is a chlorophenoxyacetic acid (CHEBI:23152) |
| 2,4-D (CHEBI:28854) is a dichlorobenzene (CHEBI:23697) |
| 2,4-D (CHEBI:28854) is conjugate acid of (2,4-dichlorophenoxy)acetate (CHEBI:19351) |
| Incoming Relation(s) |
| (2,4-dichlorophenoxy)acetate (CHEBI:19351) is conjugate base of 2,4-D (CHEBI:28854) |
| IUPAC Name |
|---|
| (2,4-dichlorophenoxy)acetic acid |
| Synonyms | Source |
|---|---|
| 2,4-Dichlorophenoxyacetate | KEGG COMPOUND |
| 2,4-Dichlorophenoxyacetic acid | KEGG COMPOUND |
| 2,4-D | KEGG COMPOUND |
| (2,4-Dichlorphenoxy)essigsäure | ChEBI |
| Hedonal | NIST Chemistry WebBook |
| Trinoxol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C03664 | KEGG COMPOUND |
| CFA | PDBeChem |
| HMDB0041797 | HMDB |
| CPD-9009 | MetaCyc |
| 2,4-Dichlorophenoxyacetic_acid | Wikipedia |
| 2,4-d | Alan Wood's Pesticides |
| LSM-19988 | LINCS |
| 4 | PPDB |
| Citations |
|---|