EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28851 - phenanthrene
| Formula | C14H10 |
| Net Charge | 0 |
| Average Mass | 178.234 |
| Monoisotopic Mass | 178.07825 |
| SMILES | c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H |
| InChIKey | YNPNZTXNASCQKK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenanthrene (CHEBI:28851) has role environmental contaminant (CHEBI:78298) |
| phenanthrene (CHEBI:28851) has role mouse metabolite (CHEBI:75771) |
| phenanthrene (CHEBI:28851) is a ortho-fused polycyclic arene (CHEBI:35296) |
| phenanthrene (CHEBI:28851) is a ortho-fused tricyclic hydrocarbon (CHEBI:37089) |
| phenanthrene (CHEBI:28851) is a phenanthrenes (CHEBI:25961) |
| Incoming Relation(s) |
| 9-phenanthrol (CHEBI:28820) has parent hydride phenanthrene (CHEBI:28851) |
| perfluorophenanthrene (CHEBI:39423) has parent hydride phenanthrene (CHEBI:28851) |
| IUPAC Name |
|---|
| phenanthrene |
| Synonyms | Source |
|---|---|
| Phenanthracene | KEGG COMPOUND |
| Phenanthrene | KEGG COMPOUND |
| Phenanthren | ChemIDplus |
| PHENANTHRENE | PDBeChem |
| Phenanthracene | KEGG COMPOUND |
| Citations |
|---|