EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O |
| Net Charge | 0 |
| Average Mass | 194.233 |
| Monoisotopic Mass | 194.07316 |
| SMILES | Oc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
| InChIKey | DZKIUEHLEXLYKM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | TRPM4 channel inhibitor An inhibitor of transient receptor potential cation channel subfamily M member 4. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-phenanthrol (CHEBI:28820) has parent hydride phenanthrene (CHEBI:28851) |
| 9-phenanthrol (CHEBI:28820) has role TRPM4 channel inhibitor (CHEBI:132608) |
| 9-phenanthrol (CHEBI:28820) is a phenanthrol (CHEBI:25962) |
| Incoming Relation(s) |
| 9-phenanthryl β-D-glucopyranoside (CHEBI:20830) has functional parent 9-phenanthrol (CHEBI:28820) |
| 9-phenanthryl β-D-glucosiduronic acid (CHEBI:20831) has functional parent 9-phenanthrol (CHEBI:28820) |
| IUPAC Name |
|---|
| phenanthren-9-ol |
| Synonyms | Source |
|---|---|
| 9-Hydroxyphenanthrene | KEGG COMPOUND |
| 9-Phenanthrol | KEGG COMPOUND |
| 9-phenanthrenol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11430 | KEGG COMPOUND |
| c0454 | UM-BBD |
| HMDB0059801 | HMDB |
| Citations |
|---|