EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@H]1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1 |
| InChIKey | KBPHJBAIARWVSC-RGZFRNHPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Biological Roles: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lutein (CHEBI:28838) has parent hydride (6'R)-β,ε-carotene (CHEBI:35147) |
| lutein (CHEBI:28838) has role food colouring (CHEBI:77182) |
| lutein (CHEBI:28838) has role plant metabolite (CHEBI:76924) |
| lutein (CHEBI:28838) is a carotenol (CHEBI:23045) |
| Incoming Relation(s) |
| lutein 5,6-epoxide (CHEBI:27448) has functional parent lutein (CHEBI:28838) |
| IUPAC Name |
|---|
| (3R,3'R,6'R)-β,ε-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| (3R,3'R,6S)-4,5-DIDEHYDRO-5,6-DIHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL | PDBeChem |
| Bo-Xan | ChemIDplus |
| E 161b | ChEBI |
| Lutein | KEGG COMPOUND |
| Xanthophyll | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| lutein | UniProt |
| Citations |
|---|