EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28838 - lutein
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@H]1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1 |
| InChIKey | KBPHJBAIARWVSC-RGZFRNHPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lutein (CHEBI:28838) has parent hydride (6'R)-β,ε-carotene (CHEBI:35147) |
| lutein (CHEBI:28838) has role antiglaucoma drug (CHEBI:39456) |
| lutein (CHEBI:28838) has role food colouring (CHEBI:77182) |
| lutein (CHEBI:28838) has role ophthalmology drug (CHEBI:66981) |
| lutein (CHEBI:28838) has role plant metabolite (CHEBI:76924) |
| lutein (CHEBI:28838) is a carotenol (CHEBI:23045) |
| Incoming Relation(s) |
| lutein 5,6-epoxide (CHEBI:27448) has functional parent lutein (CHEBI:28838) |
| IUPAC Name |
|---|
| (3R,3'R,6'R)-β,ε-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| (3R,3'R,6S)-4,5-DIDEHYDRO-5,6-DIHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL | PDBeChem |
| All-trans-xanthophyll | ChEMBL |
| Bo-Xan | ChemIDplus |
| E 161 | ChEMBL |
| E 161b | ChEBI |
| E161b | ChEMBL |
| UniProt Name | Source |
|---|---|
| lutein | UniProt |
| Citations |
|---|