EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O3 |
| Net Charge | 0 |
| Average Mass | 584.885 |
| Monoisotopic Mass | 584.42295 |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@H]1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C40H56O3/c1-29(17-13-19-31(3)21-22-36-33(5)25-34(41)26-37(36,6)7)15-11-12-16-30(2)18-14-20-32(4)23-24-40-38(8,9)27-35(42)28-39(40,10)43-40/h11-25,34-36,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,24-23+,29-15+,30-16+,31-19+,32-20+/t34-,35-,36-,39+,40-/m0/s1 |
| InChIKey | DYUUPIKEWLHQGQ-FJOIUHRLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lutein 5,6-epoxide (CHEBI:27448) has functional parent lutein (CHEBI:28838) |
| lutein 5,6-epoxide (CHEBI:27448) has role plant metabolite (CHEBI:76924) |
| lutein 5,6-epoxide (CHEBI:27448) is a epoxycarotenol (CHEBI:35307) |
| IUPAC Name |
|---|
| (3R,5R,6S,3'R,6'R)-5,6-epoxy-5,6-dihydro-β,ε-carotene-3,3'-diol |
| Synonym | Source |
|---|---|
| Lutein 5,6-epoxide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08602 | KEGG COMPOUND |
| LMPR01070275 | LIPID MAPS |
| HMDB0041590 | HMDB |
| C00003777 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:101209 | Beilstein |
| Reaxys:101209 | Reaxys |
| CAS:28368-08-3 | KEGG COMPOUND |
| Citations |
|---|