EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16032 - androsterone
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | QGXBDMJGAMFCBF-HLUDHZFRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| urine (BTO:0001419) | Article (David F. Putnam Composition and Concentrative Properties of Human Urine. NASA Contractor Report. July 1971) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (16585475) | ||
| blood (UBERON:0000178) | PubMed (17716701) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsterone (CHEBI:16032) has parent hydride 5α-androstane (CHEBI:28859) |
| androsterone (CHEBI:16032) has role androgen (CHEBI:50113) |
| androsterone (CHEBI:16032) has role anticonvulsant (CHEBI:35623) |
| androsterone (CHEBI:16032) has role human blood serum metabolite (CHEBI:85234) |
| androsterone (CHEBI:16032) has role human metabolite (CHEBI:77746) |
| androsterone (CHEBI:16032) has role human urinary metabolite (CHEBI:84087) |
| androsterone (CHEBI:16032) has role mouse metabolite (CHEBI:75771) |
| androsterone (CHEBI:16032) has role pheromone (CHEBI:26013) |
| androsterone (CHEBI:16032) is a 17-oxo steroid (CHEBI:19168) |
| androsterone (CHEBI:16032) is a 3α-hydroxy steroid (CHEBI:36835) |
| androsterone (CHEBI:16032) is a androstanoid (CHEBI:50402) |
| androsterone (CHEBI:16032) is a C19-steroid (CHEBI:131621) |
| Incoming Relation(s) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent androsterone (CHEBI:16032) |
| androsterone sulfate (CHEBI:83037) has functional parent androsterone (CHEBI:16032) |
| IUPAC Name |
|---|
| 3α-hydroxy-5α-androstan-17-one |
| Synonyms | Source |
|---|---|
| 3alpha-Hydroxy-5alpha-androstan-17-one | KEGG COMPOUND |
| 3-epihydroxyetioallocholan-17-one | ChemIDplus |
| (3α,5α)-3-hydroxyandrostan-17-one | NIST Chemistry WebBook |
| 3α-hydroxyetioallocholan-17-one | NIST Chemistry WebBook |
| 5α-androstane-3α-ol-17-one | NIST Chemistry WebBook |
| 5α-androsterone | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| androsterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5668 | ChemSpider |
| Androsterone | Wikipedia |
| ANDROSTERONE | MetaCyc |
| AOI | PDBeChem |
| C00523 | KEGG COMPOUND |
| FDB021881 | FooDB |
| HMDB0000031 | HMDB |
| LMST02020001 | LIPID MAPS |
| Citations |
|---|