EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O5 |
| Net Charge | 0 |
| Average Mass | 184.147 |
| Monoisotopic Mass | 184.03717 |
| SMILES | COc1cc(C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12) |
| InChIKey | KWCCUYSXAYTNKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-methylgallic acid (CHEBI:28647) has functional parent gallic acid (CHEBI:30778) |
| 3-O-methylgallic acid (CHEBI:28647) is a benzoic acids (CHEBI:22723) |
| 3-O-methylgallic acid (CHEBI:28647) is a catechols (CHEBI:33566) |
| 3-O-methylgallic acid (CHEBI:28647) is conjugate acid of 3-O-methylgallate (CHEBI:19950) |
| Incoming Relation(s) |
| 3-O-methylgallate (CHEBI:19950) is conjugate base of 3-O-methylgallic acid (CHEBI:28647) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-5-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 3-O-Methylgallic acid | KEGG COMPOUND |
| 4,5-Dihydroxy-m-anisic acid | ChemIDplus |
| gallic acid 3-methyl ether | ChEBI |