EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO |
| Net Charge | 0 |
| Average Mass | 71.079 |
| Monoisotopic Mass | 71.03711 |
| SMILES | C=CC(N)=O |
| InChI | InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
| InChIKey | HRPVXLWXLXDGHG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. neurotoxin A poison that interferes with the functions of the nervous system. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acrylamide (CHEBI:28619) has functional parent acrylic acid (CHEBI:18308) |
| acrylamide (CHEBI:28619) has role alkylating agent (CHEBI:22333) |
| acrylamide (CHEBI:28619) has role carcinogenic agent (CHEBI:50903) |
| acrylamide (CHEBI:28619) has role Maillard reaction product (CHEBI:77523) |
| acrylamide (CHEBI:28619) has role mutagen (CHEBI:25435) |
| acrylamide (CHEBI:28619) has role neurotoxin (CHEBI:50910) |
| acrylamide (CHEBI:28619) is a N-acylammonia (CHEBI:83628) |
| acrylamide (CHEBI:28619) is a acrylamides (CHEBI:22216) |
| acrylamide (CHEBI:28619) is a primary carboxamide (CHEBI:140324) |
| IUPAC Name |
|---|
| prop-2-enamide |
| Synonyms | Source |
|---|---|
| 2-Propenamide | KEGG COMPOUND |
| Acrylamide | KEGG COMPOUND |
| Akrylamid | NIST Chemistry WebBook |
| ethylenecarboxamide | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| acrylamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Acrylamide | Wikipedia |
| c0149 | UM-BBD |
| C01659 | KEGG COMPOUND |
| HMDB0004296 | HMDB |
| US2535245 | Patent |
| Citations |
|---|