EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O5 |
| Net Charge | 0 |
| Average Mass | 448.644 |
| Monoisotopic Mass | 448.31887 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])[C@H](O)[C@]3([H])O[C@]5(CC[C@@H](C)CO5)[C@@H](C)[C@]43[H])[C@@]1(C)C[C@@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C27H44O5/c1-14-7-10-27(31-13-14)15(2)21-24(32-27)23(30)22-17-6-5-16-11-19(28)20(29)12-26(16,4)18(17)8-9-25(21,22)3/h14-24,28-30H,5-13H2,1-4H3/t14-,15+,16+,17-,18+,19-,20-,21+,22-,23+,24-,25-,26+,27-/m1/s1 |
| InChIKey | COVOPPXLDJVUSC-JPYPKGSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptocaulon griffithii (IPNI:102037-1) | root (BTO:0001188) | PubMed (17135046) | |
| Digitalis purpurea (ncbitaxon:4164) | leaf (BTO:0000713) | DOI (10.1016/S0021-9258(18)75131-4) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| digitogenin (CHEBI:28431) has parent hydride (25R)-5α-spirostan (CHEBI:35539) |
| digitogenin (CHEBI:28431) has role plant metabolite (CHEBI:76924) |
| digitogenin (CHEBI:28431) is a 15β-hydroxy steroid (CHEBI:38090) |
| digitogenin (CHEBI:28431) is a 2α-hydroxy steroid (CHEBI:36858) |
| digitogenin (CHEBI:28431) is a 3β-hydroxy steroid (CHEBI:36836) |
| Incoming Relation(s) |
| digitonin (CHEBI:27729) has functional parent digitogenin (CHEBI:28431) |
| IUPAC Name |
|---|
| (25R)-5α-spirostan-2α,3β,15β-triol |
| Synonyms | Source |
|---|---|
| Digitogenin | KEGG COMPOUND |
| digitonin aglycon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08896 | KEGG COMPOUND |
| C00003573 | KNApSAcK |
| LMST01080004 | LIPID MAPS |
| 390462 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:94573 | Beilstein |
| CAS:511-34-2 | ChemIDplus |
| Citations |
|---|