EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H92O29 |
| Net Charge | 0 |
| Average Mass | 1229.323 |
| Monoisotopic Mass | 1228.57243 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])[C@H](O)[C@]3([H])O[C@]5(CC[C@@H](C)CO5)[C@@H](C)[C@]43[H])[C@@]1(C)C[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)[C@H]3O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@H]3O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C56H92O29/c1-19-7-10-56(75-17-19)20(2)31-45(85-56)37(67)32-22-6-5-21-11-26(24(61)12-55(21,4)23(22)8-9-54(31,32)3)76-50-42(72)39(69)44(30(16-60)80-50)81-53-48(47(36(66)29(15-59)79-53)83-49-40(70)33(63)25(62)18-74-49)84-52-43(73)46(35(65)28(14-58)78-52)82-51-41(71)38(68)34(64)27(13-57)77-51/h19-53,57-73H,5-18H2,1-4H3/t19-,20+,21+,22-,23+,24-,25-,26-,27-,28-,29-,30-,31+,32-,33+,34-,35+,36-,37+,38+,39-,40-,41-,42-,43-,44+,45-,46+,47+,48-,49+,50-,51+,52+,53+,54-,55+,56-/m1/s1 |
| InChIKey | UVYVLBIGDKGWPX-KUAJCENISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Digitalis purpurea (ncbitaxon:4164) | - | PubMed (32280324) |
| Roles Classification |
|---|
| Chemical Role: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| digitonin (CHEBI:27729) has functional parent digitogenin (CHEBI:28431) |
| digitonin (CHEBI:27729) has role detergent (CHEBI:27780) |
| digitonin (CHEBI:27729) has role plant metabolite (CHEBI:76924) |
| digitonin (CHEBI:27729) is a pentasaccharide derivative (CHEBI:63566) |
| digitonin (CHEBI:27729) is a spirostanyl glycoside (CHEBI:38091) |
| IUPAC Name |
|---|
| (25R)-2α,15β-dihydroxy-5α-spirostan-3β-yl β-D-glucopyranosyl-(1→3)-β-D-galactopyranosyl-(1→2)-[β-D-xylopyranosyl-(1→3)]-β-D-glucopyranosyl-(1→4)-β-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| Digitin | ChemIDplus |
| Digitonin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 4976216 | ChemSpider |
| C00003574 | KNApSAcK |
| C00765 | KEGG COMPOUND |
| CN101829228 | Patent |
| CPD0-1629 | MetaCyc |
| Digitonin | Wikipedia |
| LMST01080003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:78654 | Beilstein |
| CAS:11024-24-1 | KEGG COMPOUND |
| CAS:11024-24-1 | ChemIDplus |
| Citations |
|---|