EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3ClO2 |
| Net Charge | 0 |
| Average Mass | 106.508 |
| Monoisotopic Mass | 105.98216 |
| SMILES | O=C(O)/C=C/Cl |
| InChI | InChI=1S/C3H3ClO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/b2-1+ |
| InChIKey | MHMUCYJKZUZMNJ-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-chloroacrylic acid (CHEBI:28404) is a 3-chloroacrylic acid (CHEBI:19982) |
| IUPAC Name |
|---|
| (2E)-3-chloroprop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (E)-3-chloroprop-2-enoic acid | ChEBI |
| trans-3-chloroacrylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| c0620 | UM-BBD |
| C06614 | KEGG COMPOUND |
| HMDB0060515 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2345-61-1 | KEGG COMPOUND |