EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3ClO2 |
| Net Charge | 0 |
| Average Mass | 106.508 |
| Monoisotopic Mass | 105.98216 |
| SMILES | [H]C(=CCl)C(=O)O |
| InChI | InChI=1S/C3H3ClO2/c4-2-1-3(5)6/h1-2H,(H,5,6) |
| InChIKey | MHMUCYJKZUZMNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloroacrylic acid (CHEBI:19982) has functional parent acrylic acid (CHEBI:18308) |
| 3-chloroacrylic acid (CHEBI:19982) is a chlorocarboxylic acid (CHEBI:36685) |
| 3-chloroacrylic acid (CHEBI:19982) is a monocarboxylic acid (CHEBI:25384) |
| 3-chloroacrylic acid (CHEBI:19982) is conjugate acid of 3-chloroacrylate (CHEBI:62074) |
| Incoming Relation(s) |
| trans-3-chloroacrylic acid (CHEBI:28404) is a 3-chloroacrylic acid (CHEBI:19982) |
| cis-3-Chloroacrylic acid (CHEBI:27397) is a 3-chloroacrylic acid (CHEBI:19982) |
| 3-chloroacrylate (CHEBI:62074) is conjugate base of 3-chloroacrylic acid (CHEBI:19982) |
| IUPAC Name |
|---|
| 3-chloroprop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-chloro-2-propenoic acids | ChEBI |
| 3-chloroacrylic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06614 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14713319 | Reaxys |
| CAS:2345-61-1 | KEGG COMPOUND |