EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O4 |
| Net Charge | 0 |
| Average Mass | 172.140 |
| Monoisotopic Mass | 172.04841 |
| SMILES | O=C(O)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N2O4/c9-4(10)2-1-3-5(11)8-6(12)7-3/h3H,1-2H2,(H,9,10)(H2,7,8,11,12) |
| InChIKey | VWFWNXQAMGDPGG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydantoin-5-propionic acid (CHEBI:28297) has functional parent hydantoin (CHEBI:27612) |
| hydantoin-5-propionic acid (CHEBI:28297) has role metabolite (CHEBI:25212) |
| hydantoin-5-propionic acid (CHEBI:28297) has role mouse metabolite (CHEBI:75771) |
| hydantoin-5-propionic acid (CHEBI:28297) is a imidazolidine-2,4-dione (CHEBI:24628) |
| hydantoin-5-propionic acid (CHEBI:28297) is a monocarboxylic acid (CHEBI:25384) |
| hydantoin-5-propionic acid (CHEBI:28297) is conjugate acid of hydantoin-5-propionate (CHEBI:133476) |
| Incoming Relation(s) |
| hydantoin-5-propionate (CHEBI:133476) is conjugate base of hydantoin-5-propionic acid (CHEBI:28297) |
| IUPAC Name |
|---|
| 3-(2,5-dioxoimidazolidin-4-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C05565 | KEGG COMPOUND |
| HMDB0001212 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:83925 | Reaxys |
| CAS:5624-26-0 | ChemIDplus |
| Citations |
|---|