EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N2O4 |
| Net Charge | -1 |
| Average Mass | 171.132 |
| Monoisotopic Mass | 171.04113 |
| SMILES | O=C([O-])CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N2O4/c9-4(10)2-1-3-5(11)8-6(12)7-3/h3H,1-2H2,(H,9,10)(H2,7,8,11,12)/p-1 |
| InChIKey | VWFWNXQAMGDPGG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydantoin-5-propionate (CHEBI:133476) has role mouse metabolite (CHEBI:75771) |
| hydantoin-5-propionate (CHEBI:133476) is a monocarboxylic acid anion (CHEBI:35757) |
| hydantoin-5-propionate (CHEBI:133476) is conjugate base of hydantoin-5-propionic acid (CHEBI:28297) |
| Incoming Relation(s) |
| S-methyl-thiohydantoin-5-propanoate (CHEBI:229685) has functional parent hydantoin-5-propionate (CHEBI:133476) |
| hydantoin-5-propionic acid (CHEBI:28297) is conjugate acid of hydantoin-5-propionate (CHEBI:133476) |
| IUPAC Name |
|---|
| 3-(2,5-dioxoimidazolidin-4-yl)propanoate |
| Synonym | Source |
|---|---|
| hydantoin-5-propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| hydantoin-5-propanoate | UniProt |