EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6OS |
| Net Charge | 0 |
| Average Mass | 78.136 |
| Monoisotopic Mass | 78.01394 |
| SMILES | CS(C)=O |
| InChI | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
| InChIKey | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. antidote Any protective agent counteracting or neutralizing the action of poisons. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl sulfoxide (CHEBI:28262) has role Escherichia coli metabolite (CHEBI:76971) |
| dimethyl sulfoxide (CHEBI:28262) has role alkylating agent (CHEBI:22333) |
| dimethyl sulfoxide (CHEBI:28262) has role antidote (CHEBI:50247) |
| dimethyl sulfoxide (CHEBI:28262) has role geroprotector (CHEBI:176497) |
| dimethyl sulfoxide (CHEBI:28262) has role MRI contrast agent (CHEBI:37335) |
| dimethyl sulfoxide (CHEBI:28262) has role non-narcotic analgesic (CHEBI:35481) |
| dimethyl sulfoxide (CHEBI:28262) has role polar aprotic solvent (CHEBI:48358) |
| dimethyl sulfoxide (CHEBI:28262) has role radical scavenger (CHEBI:48578) |
| dimethyl sulfoxide (CHEBI:28262) is a sulfoxide (CHEBI:22063) |
| dimethyl sulfoxide (CHEBI:28262) is a volatile organic compound (CHEBI:134179) |
| Incoming Relation(s) |
| trametinib dimethyl sulfoxide (CHEBI:75991) has part dimethyl sulfoxide (CHEBI:28262) |
| IUPAC Names |
|---|
| dimethyl sulfoxide |
| (methanesulfinyl)methane |
| INNs | Source |
|---|---|
| dimethyli sulfoxidum | ChemIDplus |
| dimethyl sulfoxide | ChemIDplus |
| diméthylsulfoxyde | ChemIDplus |
| dimetil sulfóxido | ChemIDplus |
| Synonyms | Source |
|---|---|
| (CH3)2SO | NIST Chemistry WebBook |
| Dimethylsulfoxid | ChEBI |
| Dimethyl sulfoxide | KEGG COMPOUND |
| DIMETHYL SULFOXIDE | PDBeChem |
| dimethyl sulfur oxide | NIST Chemistry WebBook |
| dimethyl sulphoxide | ChemIDplus |
| UniProt Name | Source |
|---|---|
| dimethyl sulfoxide | UniProt |
| Citations |
|---|