EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O3 |
| Net Charge | 0 |
| Average Mass | 220.228 |
| Monoisotopic Mass | 220.08479 |
| SMILES | NC(Cc1cnc2ccc(O)cc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| InChIKey | LDCYZAJDBXYCGN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxytryptophan (CHEBI:28171) has role human metabolite (CHEBI:77746) |
| 5-hydroxytryptophan (CHEBI:28171) has role neurotransmitter (CHEBI:25512) |
| 5-hydroxytryptophan (CHEBI:28171) is a hydroxytryptophan (CHEBI:84194) |
| Incoming Relation(s) |
| 5-hydroxy-D-tryptophan (CHEBI:43186) is a 5-hydroxytryptophan (CHEBI:28171) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) is a 5-hydroxytryptophan (CHEBI:28171) |
| IUPAC Names |
|---|
| 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| 5-hydroxytryptophan |
| Synonyms | Source |
|---|---|
| 5-HTP | KEGG COMPOUND |
| 5-hydroxy-DL-tryptophan | ChemIDplus |
| (±)-5-hydroxytryptophan | ChemIDplus |
| 5-Hydroxytryptophan | KEGG COMPOUND |
| 5-hydroxytryptophan DL-form | ChemIDplus |
| DL-5-HTP | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5-Hydroxytryptophan | Wikipedia |
| C00001371 | KNApSAcK |
| C01017 | KEGG COMPOUND |
| Citations |
|---|