EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O3 |
| Net Charge | 0 |
| Average Mass | 220.228 |
| Monoisotopic Mass | 220.08479 |
| SMILES | N[C@@H](Cc1cnc2ccc(O)cc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | LDCYZAJDBXYCGN-VIFPVBQESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) has role anti-obesity agent (CHEBI:74518) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) has role antidepressant (CHEBI:35469) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) has role human metabolite (CHEBI:77746) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) has role mouse metabolite (CHEBI:75771) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) has role plant metabolite (CHEBI:76924) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) is a 5-hydroxytryptophan (CHEBI:28171) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) is a hydroxy-L-tryptophan (CHEBI:47995) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) is enantiomer of 5-hydroxy-D-tryptophan (CHEBI:43186) |
| 5-hydroxy-L-tryptophan (CHEBI:17780) is tautomer of 5-hydroxy-L-tryptophan zwitterion (CHEBI:58266) |
| Incoming Relation(s) |
| 5-hydroxy-D-tryptophan (CHEBI:43186) is enantiomer of 5-hydroxy-L-tryptophan (CHEBI:17780) |
| 5-hydroxy-L-tryptophan zwitterion (CHEBI:58266) is tautomer of 5-hydroxy-L-tryptophan (CHEBI:17780) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| 5-hydroxy-L-tryptophan |
| Synonyms | Source |
|---|---|
| 5-hydroxy-L-tryptophan | ChEBI |
| 5-Hydroxy-L-tryptophan | KEGG COMPOUND |
| 5-hydroxytryptophan, dl- | ChEMBL |
| 5-hydroxytryptophan L-form | ChemIDplus |
| Cincofarm | ChemIDplus |
| Dl-hydroxytryptophan | ChEMBL |
| Brand Name | Source |
|---|---|
| Levotonine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4006 | DrugCentral |
| 4PQ | PDBeChem |
| 5-Hydroxytryptophan | Wikipedia |
| 5-HYDROXY-TRYPTOPHAN | MetaCyc |
| C00001371 | KNApSAcK |
| C00643 | KEGG COMPOUND |
| D07339 | KEGG DRUG |
| DB02959 | DrugBank |
| HMDB0000472 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1862149 | Gmelin |
| Reaxys:88200 | Reaxys |
| CAS:4350-09-8 | KEGG COMPOUND |
| CAS:4350-09-8 | ChemIDplus |
| Citations |
|---|