EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O |
| Net Charge | 0 |
| Average Mass | 200.241 |
| Monoisotopic Mass | 200.09496 |
| SMILES | CC1=NCCc2c1nc1cc(O)ccc21 |
| InChI | InChI=1S/C12H12N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-3,6,14-15H,4-5H2,1H3 |
| InChIKey | RHVPEFQDYMMNSY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Undaria pinnatifida (ncbitaxon:74381) | - | PubMed (25749794) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| harmalol (CHEBI:27943) has parent hydride harman (CHEBI:5623) |
| harmalol (CHEBI:27943) has role algal metabolite (CHEBI:84735) |
| harmalol (CHEBI:27943) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| harmalol (CHEBI:27943) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-7-ol |
| Synonyms | Source |
|---|---|
| 1-methyl-4,9-dihydro-3H-β-carbolin-7-ol | IUPAC |
| Harmalol | KEGG COMPOUND |
| Harmidol | ChemIDplus |
| Harmolol | ChemIDplus |
| Citations |
|---|