EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O4 |
| Net Charge | 0 |
| Average Mass | 120.104 |
| Monoisotopic Mass | 120.04226 |
| SMILES | O=C[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4+/m0/s1 |
| InChIKey | YTBSYETUWUMLBZ-IUYQGCFVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (10952545) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythrose (CHEBI:27904) has role plant metabolite (CHEBI:76924) |
| D-erythrose (CHEBI:27904) is a erythrose (CHEBI:33946) |
| D-erythrose (CHEBI:27904) is enantiomer of L-erythrose (CHEBI:21288) |
| Incoming Relation(s) |
| D-erythrose 4-phosphate (CHEBI:48153) has functional parent D-erythrose (CHEBI:27904) |
| D-erythrose 4-phosphate(2−) (CHEBI:16897) has functional parent D-erythrose (CHEBI:27904) |
| 4-deoxy-4-sulfo-D-erythrose(1−) (CHEBI:189857) has functional parent D-erythrose (CHEBI:27904) |
| L-erythrose (CHEBI:21288) is enantiomer of D-erythrose (CHEBI:27904) |
| IUPAC Names |
|---|
| D-erythrose |
| D-erythro-tetrose |
| (2R,3R)-2,3,4-trihydroxybutanal |
| Synonym | Source |
|---|---|
| D-Erythrose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| D-erythrose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01796 | KEGG COMPOUND |
| Erythrose | Wikipedia |
| HMDB0002649 | HMDB |
| C00007412 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5805561 | Reaxys |
| CAS:583-50-6 | KEGG COMPOUND |
| CAS:583-50-6 | ChemIDplus |
| Citations |
|---|