EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O4 |
| Net Charge | 0 |
| Average Mass | 120.104 |
| Monoisotopic Mass | 120.04226 |
| SMILES | [H][C@](O)(CO)[C@]([H])(O)C=O |
| InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4+/m1/s1 |
| InChIKey | YTBSYETUWUMLBZ-DMTCNVIQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythrose (CHEBI:21288) is a erythrose (CHEBI:33946) |
| L-erythrose (CHEBI:21288) is enantiomer of D-erythrose (CHEBI:27904) |
| Incoming Relation(s) |
| 3-dehydro-L-erythrose 4-phosphate (CHEBI:63321) has functional parent L-erythrose (CHEBI:21288) |
| D-erythrose (CHEBI:27904) is enantiomer of L-erythrose (CHEBI:21288) |
| IUPAC Names |
|---|
| L-erythrose |
| L-erythro-tetrose |
| Synonym | Source |
|---|---|
| L-(+)-Erythrose | ChemIDplus |