EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2789 - apraclonidine hydrochloride
| Formula | C9H10Cl2N4.HCl |
| Net Charge | 0 |
| Average Mass | 281.574 |
| Monoisotopic Mass | 280.00493 |
| SMILES | Cl.Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N4.ClH/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9;/h3-4H,1-2,12H2,(H2,13,14,15);1H |
| InChIKey | OTQYGBJVDRBCHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apraclonidine hydrochloride (CHEBI:2789) has part apraclonidine (CHEBI:2788) |
| apraclonidine hydrochloride (CHEBI:2789) has role antiglaucoma drug (CHEBI:39456) |
| apraclonidine hydrochloride (CHEBI:2789) has role α-adrenergic agonist (CHEBI:35569) |
| apraclonidine hydrochloride (CHEBI:2789) is a hydrochloride (CHEBI:36807) |
| INNs | Source |
|---|---|
| apraclonidine | ChEBI |
| apraclonidina | DrugBank |
| apraclonidinum | DrugBank |
| Synonyms | Source |
|---|---|
| Apraclonidine HCl | ChemIDplus |
| 2,6-Dichloro-N1-(2-imidazolidinylidene)-1,4-benzenediamine hydrochloride | ChemIDplus |
| 2,6-Dichloro-N1-(4,5-dihydro-1H-imidazol-2-yl)-1,4-benzenediamine monohydrochloride | ChemIDplus |
| 2-((4-Amino-2,6-dichlorophenyl)imino)imidazolidine monohydrochloride | ChemIDplus |
| 2-(4-Amino-2,6-dichlorophenylimino)imidazolidine hydrochloride | ChemIDplus |
| 3,5-Dichloro-4-(2-imidazolidinylidenimino)aniline hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8802997 | Beilstein |
| CAS:73218-79-8 | KEGG DRUG |
| CAS:73218-79-8 | ChemIDplus |