EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10Cl2N4 |
| Net Charge | 0 |
| Average Mass | 245.113 |
| Monoisotopic Mass | 244.02825 |
| SMILES | Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N4/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9/h3-4H,1-2,12H2,(H2,13,14,15) |
| InChIKey | IEJXVRYNEISIKR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apraclonidine (CHEBI:2788) has role antiglaucoma drug (CHEBI:39456) |
| apraclonidine (CHEBI:2788) has role diagnostic agent (CHEBI:33295) |
| apraclonidine (CHEBI:2788) has role ophthalmology drug (CHEBI:66981) |
| apraclonidine (CHEBI:2788) has role α-adrenergic agonist (CHEBI:35569) |
| apraclonidine (CHEBI:2788) has role β-adrenergic agonist (CHEBI:35522) |
| apraclonidine (CHEBI:2788) is a dichlorobenzene (CHEBI:23697) |
| apraclonidine (CHEBI:2788) is a guanidines (CHEBI:24436) |
| apraclonidine (CHEBI:2788) is a imidazolines (CHEBI:53095) |
| apraclonidine (CHEBI:2788) is conjugate base of apraclonidine(1+) (CHEBI:134252) |
| Incoming Relation(s) |
| apraclonidine hydrochloride (CHEBI:2789) has part apraclonidine (CHEBI:2788) |
| apraclonidine(1+) (CHEBI:134252) is conjugate acid of apraclonidine (CHEBI:2788) |
| IUPAC Name |
|---|
| 2,6-dichloro-N1-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine |
| INNs | Source |
|---|---|
| apraclonidina | DrugBank |
| apraclonidine | KEGG DRUG |
| apraclonidinum | DrugBank |
| Synonym | Source |
|---|---|
| 4-Aminoclonidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5436106 | Beilstein |
| CAS:66711-21-5 | KEGG COMPOUND |
| CAS:66711-21-5 | KEGG DRUG |
| CAS:66711-21-5 | DrugBank |
| CAS:66711-21-5 | ChemIDplus |
| Citations |
|---|