EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H75NO17 |
| Net Charge | 0 |
| Average Mass | 938.118 |
| Monoisotopic Mass | 937.50350 |
| SMILES | [H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(=O)OC)O2 |
| InChI | InChI=1S/C48H75NO17/c1-28-18-16-14-12-10-8-6-7-9-11-13-15-17-19-35(65-47-45(59)42(49)44(58)31(4)64-47)25-39-41(46(60)62-5)38(55)27-48(61,66-39)26-34(52)23-37(54)36(53)21-20-32(50)22-33(51)24-40(56)63-30(3)29(2)43(28)57/h6-19,28-39,41-45,47,50-55,57-59,61H,20-27,49H2,1-5H3/b7-6+,10-8+,11-9+,14-12+,15-13+,18-16+,19-17+/t28-,29-,30-,31+,32+,33+,34-,35-,36+,37+,38-,39-,41+,42-,43+,44+,45-,47-,48+/m0/s1 |
| InChIKey | UAZIZEMIKKIBCA-TYVGYKFWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amphotericin B methyl ester (CHEBI:277842) has functional parent amphotericin B (CHEBI:2682) |
| amphotericin B methyl ester (CHEBI:277842) has role antifungal agent (CHEBI:35718) |
| amphotericin B methyl ester (CHEBI:277842) has role antiinfective agent (CHEBI:35441) |
| amphotericin B methyl ester (CHEBI:277842) has role metabolite (CHEBI:25212) |
| amphotericin B methyl ester (CHEBI:277842) is a macrolide (CHEBI:25106) |
| amphotericin B methyl ester (CHEBI:277842) is a methyl ester (CHEBI:25248) |
| amphotericin B methyl ester (CHEBI:277842) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate |
| Synonyms | Source |
|---|---|
| AME | ChEBI |
| Amphotericin B Me Ester | ChEMBL |
| Methylamphotericin B | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6264916 | Reaxys |
| CAS:36148-89-7 | ChemIDplus |
| Citations |
|---|