EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H73NO17 |
| Net Charge | 0 |
| Average Mass | 924.091 |
| Monoisotopic Mass | 923.48785 |
| SMILES | [H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(=O)O)O2 |
| InChI | InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1 |
| InChIKey | APKFDSVGJQXUKY-INPOYWNPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amphotericin B (CHEBI:2682) has role antiamoebic agent (CHEBI:171664) |
| amphotericin B (CHEBI:2682) has role antibacterial agent (CHEBI:33282) |
| amphotericin B (CHEBI:2682) has role antihypertensive agent (CHEBI:35674) |
| amphotericin B (CHEBI:2682) has role antiinfective agent (CHEBI:35441) |
| amphotericin B (CHEBI:2682) has role antileishmanial agent (CHEBI:70868) |
| amphotericin B (CHEBI:2682) has role antineoplastic agent (CHEBI:35610) |
| amphotericin B (CHEBI:2682) has role antiprotozoal drug (CHEBI:35820) |
| amphotericin B (CHEBI:2682) has role bacterial metabolite (CHEBI:76969) |
| amphotericin B (CHEBI:2682) is a antibiotic antifungal drug (CHEBI:87113) |
| amphotericin B (CHEBI:2682) is a macrolide antibiotic (CHEBI:25105) |
| amphotericin B (CHEBI:2682) is a polyene antibiotic (CHEBI:26177) |
| Incoming Relation(s) |
| amphotericin B methyl ester (CHEBI:277842) has functional parent amphotericin B (CHEBI:2682) |
| IUPAC Name |
|---|
| (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
| INNs | Source |
|---|---|
| amfotericina B | ChemIDplus |
| amphotericin B | KEGG DRUG |
| amphotericine B | ChemIDplus |
| amphotericinum B | ChemIDplus |
| Synonyms | Source |
|---|---|
| Abelcet, liposomal amphotericin b | ChEMBL |
| Ambil | ChEMBL |
| AMPH-B | DrugBank |
| Amphotericin | ChEMBL |
| Amphotericin b deoxycholate | ChEMBL |
| Amphotericin b lipid complex | ChEMBL |
| Brand Names | Source |
|---|---|
| Ambisome | ChEMBL |
| Amophotericin b | ChEMBL |
| Ampho-moronal | ChEMBL |
| Amphotec | ChEMBL |
| Amphotercin b | ChEMBL |
| Amphotericitin b | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 197 | DrugCentral |
| Amphotericin_B | Wikipedia |
| C06573 | KEGG COMPOUND |
| D00203 | KEGG DRUG |
| DB00681 | DrugBank |
| LMPK06000002 | LIPID MAPS |
| US2908611 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4645978 | Reaxys |
| CAS:1397-89-3 | DrugBank |
| CAS:1397-89-3 | ChemIDplus |
| CAS:1397-89-3 | KEGG DRUG |
| CAS:1397-89-3 | KEGG COMPOUND |
| Citations |
|---|