EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H73NO17 |
| Net Charge | 0 |
| Average Mass | 924.091 |
| Monoisotopic Mass | 923.48785 |
| SMILES | [H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(=O)O)O2 |
| InChI | InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1 |
| InChIKey | APKFDSVGJQXUKY-INPOYWNPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amphotericin B (CHEBI:2682) has role antiamoebic agent (CHEBI:171664) |
| amphotericin B (CHEBI:2682) has role antiprotozoal drug (CHEBI:35820) |
| amphotericin B (CHEBI:2682) has role bacterial metabolite (CHEBI:76969) |
| amphotericin B (CHEBI:2682) is a antibiotic antifungal drug (CHEBI:87113) |
| amphotericin B (CHEBI:2682) is a macrolide antibiotic (CHEBI:25105) |
| amphotericin B (CHEBI:2682) is a polyene antibiotic (CHEBI:26177) |
| Incoming Relation(s) |
| amphotericin B methyl ester (CHEBI:277842) has functional parent amphotericin B (CHEBI:2682) |
| IUPAC Name |
|---|
| (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
| INNs | Source |
|---|---|
| amphotericin B | KEGG DRUG |
| amfotericina B | ChemIDplus |
| amphotericine B | ChemIDplus |
| amphotericinum B | ChemIDplus |
| Synonyms | Source |
|---|---|
| AMPH-B | DrugBank |
| Amphotericine B | DrugBank |
| Liposomal Amphotericin B | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C06573 | KEGG COMPOUND |
| D00203 | KEGG DRUG |
| DB00681 | DrugBank |
| US2908611 | Patent |
| LMPK06000002 | LIPID MAPS |
| Amphotericin_B | Wikipedia |
| 197 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4645978 | Reaxys |
| CAS:1397-89-3 | KEGG COMPOUND |
| CAS:1397-89-3 | KEGG DRUG |
| CAS:1397-89-3 | DrugBank |
| CAS:1397-89-3 | ChemIDplus |
| Citations |
|---|