EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H39N5O7 |
| Net Charge | 0 |
| Average Mass | 449.549 |
| Monoisotopic Mass | 449.28495 |
| SMILES | CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O |
| InChI | InChI=1S/C19H39N5O7/c1-19(27)7-28-18(13(26)16(19)24-2)31-15-11(23)5-10(22)14(12(15)25)30-17-9(21)4-3-8(6-20)29-17/h8-18,24-27H,3-7,20-23H2,1-2H3/t8-,9+,10-,11+,12-,13+,14+,15-,16+,17+,18+,19-/m0/s1 |
| InChIKey | VEGXETMJINRLTH-BOZYPMBZSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentamycin C1a (CHEBI:27784) is a gentamycin C (CHEBI:28417) |
| gentamycin C1a (CHEBI:27784) is conjugate base of gentamycin C1a(5+) (CHEBI:58530) |
| Incoming Relation(s) |
| etimicin (CHEBI:134705) has functional parent gentamycin C1a (CHEBI:27784) |
| gentamycin C1a(5+) (CHEBI:58530) is conjugate acid of gentamycin C1a (CHEBI:27784) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyloxy]-2-hydroxycyclohexyl 2,6-diamino-2,3,4,6-tetradeoxy-α-D-erythro-hexopyranoside |
| Synonyms | Source |
|---|---|
| Gentamicin C1a | KEGG COMPOUND |
| Gentamycin C12 | ChemIDplus |
| O-3-deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6)-O-(2,6-diamino-2,3,4,6-tetradeoxy-alpha-D-erythro-hexopyranosyl-(1-4))-2-deoxy-D-streptamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:26098-04-4 | KEGG COMPOUND |
| CAS:26098-04-4 | ChemIDplus |