EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H43N5O7 |
| Net Charge | 0 |
| Average Mass | 477.603 |
| Monoisotopic Mass | 477.31625 |
| SMILES | CCN[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1OC[C@](C)(O)[C@H](NC)[C@H]1O |
| InChI | InChI=1S/C21H43N5O7/c1-4-26-13-7-12(24)16(32-19-11(23)6-5-10(8-22)31-19)14(27)17(13)33-20-15(28)18(25-3)21(2,29)9-30-20/h10-20,25-29H,4-9,22-24H2,1-3H3/t10-,11+,12-,13+,14-,15+,16+,17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | NZGMVSJQULXLHF-RAKCNUBFSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etimicin (CHEBI:134705) has functional parent gentamycin C1a (CHEBI:27784) |
| etimicin (CHEBI:134705) has role antibacterial agent (CHEBI:33282) |
| etimicin (CHEBI:134705) is a amino cyclitol glycoside (CHEBI:22479) |
| etimicin (CHEBI:134705) is a aminoglycoside antibiotic (CHEBI:22507) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-6-amino-3-{[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl]oxy}-4-(ethylamino)-2-hydroxycyclohexyl 2,6-diamino-2,3,4,6-tetradeoxy-α-D-erythro-hexopyranoside |
| Synonyms | Source |
|---|---|
| etilmicin | ChemIDplus |
| etimicin | ChemIDplus |
| antibiotic 89-07 | ChemIDplus |
| N1-ethylgentamicin C1a | ChemIDplus |
| 1-N-ethylgentamicin C1a | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:59711-96-5 | ChemIDplus |
| Citations |
|---|