EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO5 |
| Net Charge | 0 |
| Average Mass | 223.184 |
| Monoisotopic Mass | 223.04807 |
| SMILES | Nc1c(O)cccc1C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C10H9NO5/c11-9-5(2-1-3-6(9)12)7(13)4-8(14)10(15)16/h1-3,12H,4,11H2,(H,15,16) |
| InChIKey | YCJNYHCCOXVYAF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (28900168) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) has role rat metabolite (CHEBI:86264) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) is a phenols (CHEBI:33853) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) is a substituted aniline (CHEBI:48975) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) is conjugate acid of 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate (CHEBI:157756) |
| Incoming Relation(s) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate (CHEBI:157756) is conjugate base of 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) |
| IUPAC Name |
|---|
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid |
| Synonym | Source |
|---|---|
| 2-amino-3-hydroxy-α,γ-dioxobenzenebutanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C05645 | KEGG COMPOUND |
| HMDB0004083 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:857760-67-9 | HMDB |
| Citations |
|---|