EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8NO5 |
| Net Charge | -1 |
| Average Mass | 222.176 |
| Monoisotopic Mass | 222.04080 |
| SMILES | Nc1c(O)cccc1C(=O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C10H9NO5/c11-9-5(2-1-3-6(9)12)7(13)4-8(14)10(15)16/h1-3,12H,4,11H2,(H,15,16)/p-1 |
| InChIKey | YCJNYHCCOXVYAF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate (CHEBI:157756) is a dioxo monocarboxylic acid anion (CHEBI:35979) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate (CHEBI:157756) is conjugate base of 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) |
| Incoming Relation(s) |
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid (CHEBI:27593) is conjugate acid of 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate (CHEBI:157756) |
| IUPAC Name |
|---|
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
| UniProt Name | Source |
|---|---|
| 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-11552 | MetaCyc |
| Citations |
|---|