EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27565 - 4-aminosalicylic acid
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C7H7NO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,8H2,(H,10,11) |
| InChIKey | WUBBRNOQWQTFEX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminosalicylic acid (CHEBI:27565) has functional parent salicylic acid (CHEBI:16914) |
| 4-aminosalicylic acid (CHEBI:27565) has role antitubercular agent (CHEBI:33231) |
| 4-aminosalicylic acid (CHEBI:27565) is a aminobenzoic acid (CHEBI:22495) |
| 4-aminosalicylic acid (CHEBI:27565) is a phenols (CHEBI:33853) |
| 4-aminosalicylic acid (CHEBI:27565) is conjugate acid of 4-aminosalicylate(1−) (CHEBI:137598) |
| Incoming Relation(s) |
| 4-aminosalicylate(1−) (CHEBI:137598) is conjugate base of 4-aminosalicylic acid (CHEBI:27565) |
| IUPAC Name |
|---|
| 4-amino-2-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2-HYDROXY-4-AMINOBENZOIC ACID | PDBeChem |
| 4-Aminosalicylate | KEGG COMPOUND |
| 4-Aminosalicylic acid | KEGG COMPOUND |
| Aminosalicylic acid | ChemIDplus |
| p-aminosalicylic acid | NIST Chemistry WebBook |
| Para-amino salicylic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Paser | DrugBank |
| Citations |
|---|