EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O6 |
| Net Charge | 0 |
| Average Mass | 366.454 |
| Monoisotopic Mass | 366.20424 |
| SMILES | O=C(O)CCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O6/c21-17(11-6-2-1-3-9-15-19(23)24)12-7-4-5-8-13-18(22)14-10-16-20(25)26/h2,4-8,12-13,17-18,21-22H,1,3,9-11,14-16H2,(H,23,24)(H,25,26)/b5-4+,6-2-,12-7+,13-8-/t17-,18-/m1/s1 |
| InChIKey | SXWGPVJGNOLNHT-VFLUTPEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) has functional parent leukotriene B4 (CHEBI:15647) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) has role human blood serum metabolite (CHEBI:85234) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) has role human urinary metabolite (CHEBI:84087) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) is a hydroxy carboxylic acid (CHEBI:24669) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) is a leukotriene (CHEBI:25029) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) is conjugate acid of 20-hydroxy-20-oxoleukotriene B4(2−) (CHEBI:90722) |
| Incoming Relation(s) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) has functional parent 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) |
| 20-hydroxy-20-oxoleukotriene B4(2−) (CHEBI:90722) is conjugate base of 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenedioic acid |
| Synonyms | Source |
|---|---|
| 20-Carboxy-leukotriene B4 | KEGG COMPOUND |
| 20-carboxy-LTB4 | LIPID MAPS |
| 20-COOH-Leukotriene B4 | KEGG COMPOUND |
| 20-COOH-LTB4 | KEGG COMPOUND |
| 5,12-Dihydroxy-delta5,8,11,14-eicosapolyendioic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05950 | KEGG COMPOUND |
| LMFA03020016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:80434-82-8 | ChemIDplus |