EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O12 |
| Net Charge | 0 |
| Average Mass | 542.578 |
| Monoisotopic Mass | 542.23633 |
| SMILES | O=C(O)CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H38O12/c27-17(12-7-4-5-8-13-18(28)14-10-15-19(29)30)11-6-2-1-3-9-16-20(31)37-26-23(34)21(32)22(33)24(38-26)25(35)36/h2,4-8,12-13,17-18,21-24,26-28,32-34H,1,3,9-11,14-16H2,(H,29,30)(H,35,36)/b5-4+,6-2-,12-7+,13-8-/t17-,18-,21+,22+,23-,24+,26-/m1/s1 |
| InChIKey | UAMFSIWNQKWRCK-QWILEGIPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) has functional parent 20-hydroxy-20-oxoleukotriene B4 (CHEBI:27562) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) is a O-acyl carbohydrate (CHEBI:52782) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) is a dicarboxylic acid (CHEBI:35692) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) is a glucosiduronic acid (CHEBI:24302) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) is a leukotriene (CHEBI:25029) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) is conjugate acid of 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide)(2−) (CHEBI:136546) |
| Incoming Relation(s) |
| 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide)(2−) (CHEBI:136546) is conjugate base of 20-hydroxy-20-oxoleukotriene B4-20-(β-D-glucuronide) (CHEBI:137383) |
| IUPAC Name |
|---|
| 1-O-[(6Z,9R,10E,12E,14Z,16S)-19-carboxy-9,16-dihydroxynonadeca-6,10,12,14-tetraenoyl]-β-D-glucopyranuronic acid |
| Synonym | Source |
|---|---|
| 20-carboxyleukotriene B4-20-(β-D-glucuronide) | ChEBI |