EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27436 - methyltestosterone
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h12,15-17,22H,4-11H2,1-3H3/t15-,16+,17+,18+,19+,20+/m1/s1 |
| InChIKey | GCKMFJBGXUYNAG-HLXURNFRSA-N |
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyltestosterone (CHEBI:27436) has functional parent testosterone (CHEBI:17347) |
| methyltestosterone (CHEBI:27436) has role anabolic agent (CHEBI:36413) |
| methyltestosterone (CHEBI:27436) has role androgen (CHEBI:50113) |
| methyltestosterone (CHEBI:27436) has role antineoplastic agent (CHEBI:35610) |
| methyltestosterone (CHEBI:27436) is a 17β-hydroxy steroid (CHEBI:35343) |
| methyltestosterone (CHEBI:27436) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| methyltestosterone (CHEBI:27436) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| (17β)-17-hydroxy-17-methylandrost-4-en-3-one |
| INNs | Source |
|---|---|
| methyltestosteronum | ChemIDplus |
| metiltestosterona | ChemIDplus |
| methyltestosterone | ChemIDplus |
| Synonyms | Source |
|---|---|
| Methyltestosterone | KEGG COMPOUND |
| 4-androstene-17α-methyl-17β-ol-3-one | ChemIDplus |
| 17β-hydroxy-17-methylandrost-4-en-3-one | ChemIDplus |
| 17(α)-methyl-Δ4-androsten-17(β)-ol-3-one | ChemIDplus |
| 17α-methyltestosterone | ChemIDplus |
| 17α-methyl-3-oxo-4-androsten-17β-ol | ChemIDplus |
| Brand Names | Source |
|---|---|
| Virilon | DrugBank |
| Testred | DrugBank |
| Android | DrugBank |
| Citations |
|---|