EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27430 - 7-O-methylluteone
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | COc1cc2occ(-c3ccc(O)cc3O)c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-6-14-17(26-3)9-18-19(20(14)24)21(25)15(10-27-18)13-7-5-12(22)8-16(13)23/h4-5,7-10,22-24H,6H2,1-3H3 |
| InChIKey | AZPLXDBZIQMMMT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-methylluteone (CHEBI:27430) has functional parent luteone (CHEBI:27917) |
| 7-O-methylluteone (CHEBI:27430) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| 7-O-methylluteone (CHEBI:27430) has role metabolite (CHEBI:25212) |
| 7-O-methylluteone (CHEBI:27430) is a 7-methoxyisoflavones (CHEBI:140356) |
| 7-O-methylluteone (CHEBI:27430) is a hydroxyisoflavone (CHEBI:38755) |
| 7-O-methylluteone (CHEBI:27430) is conjugate acid of 7-O-methylluteone(1−) (CHEBI:77801) |
| Incoming Relation(s) |
| 7-O-methylluteone(1−) (CHEBI:77801) is conjugate base of 7-O-methylluteone (CHEBI:27430) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | ChEBI |
| 5,2',4'-trihydroxy-7-methoxy-6-(3-methylbut-2-enyl)isoflavone | ChEBI |
| 7-O-methylluteone | ChEBI |
| 7-O-Methylluteone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 7-O-METHYLLUTEON | MetaCyc |
| 7-O-Methylluteone | Wikipedia |
| C00019056 | KNApSAcK |
| C07290 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4334565 | Reaxys |
| CAS:122290-50-0 | Beilstein |
| Citations |
|---|