EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | COc1cc2occ(-c3ccc(O)cc3O)c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-6-14-17(26-3)9-18-19(20(14)24)21(25)15(10-27-18)13-7-5-12(22)8-16(13)23/h4-5,7-10,22-24H,6H2,1-3H3 |
| InChIKey | AZPLXDBZIQMMMT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-methylluteone (CHEBI:27430) has functional parent luteone (CHEBI:27917) |
| 7-O-methylluteone (CHEBI:27430) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| 7-O-methylluteone (CHEBI:27430) has role metabolite (CHEBI:25212) |
| 7-O-methylluteone (CHEBI:27430) is a 7-methoxyisoflavones (CHEBI:140356) |
| 7-O-methylluteone (CHEBI:27430) is a hydroxyisoflavone (CHEBI:38755) |
| 7-O-methylluteone (CHEBI:27430) is conjugate acid of 7-O-methylluteone(1−) (CHEBI:77801) |
| Incoming Relation(s) |
| 7-O-methylluteone(1−) (CHEBI:77801) is conjugate base of 7-O-methylluteone (CHEBI:27430) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 7-O-Methylluteone | KEGG COMPOUND |
| 7-O-methylluteone | ChEBI |
| 3-(2,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | ChEBI |
| 5,2',4'-trihydroxy-7-methoxy-6-(3-methylbut-2-enyl)isoflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07290 | KEGG COMPOUND |
| 7-O-METHYLLUTEON | MetaCyc |
| 7-O-Methylluteone | Wikipedia |
| C00019056 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4334565 | Reaxys |
| CAS:122290-50-0 | Beilstein |
| Citations |
|---|