EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O6 |
| Net Charge | 0 |
| Average Mass | 244.203 |
| Monoisotopic Mass | 244.06954 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | DRTQHJPVMGBUCF-XVFCMESISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fundamental metabolite Any metabolite produced by all living cells. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uridine (CHEBI:16704) has functional parent uracil (CHEBI:17568) |
| uridine (CHEBI:16704) has role antineoplastic agent (CHEBI:35610) |
| uridine (CHEBI:16704) has role antipsychotic agent (CHEBI:35476) |
| uridine (CHEBI:16704) has role drug metabolite (CHEBI:49103) |
| uridine (CHEBI:16704) has role fundamental metabolite (CHEBI:78675) |
| uridine (CHEBI:16704) has role human metabolite (CHEBI:77746) |
| uridine (CHEBI:16704) has role ophthalmology drug (CHEBI:66981) |
| uridine (CHEBI:16704) is a uridines (CHEBI:27242) |
| Incoming Relation(s) |
| (5'S,6'R)-C-glycyluridine zwitterion (CHEBI:195553) has functional parent uridine (CHEBI:16704) |
| (5'S,6'S)-C-glycyluridine zwitterion (CHEBI:229461) has functional parent uridine (CHEBI:16704) |
| 3'-(enolpyruvyl)uridine 5'-monophosphate (CHEBI:133864) has functional parent uridine (CHEBI:16704) |
| 5-aminomethyl-2-thiouridine (CHEBI:73768) has functional parent uridine (CHEBI:16704) |
| 5'-O-(dihydroxyphosphanyl)-2'-O-{2-[2-(dimethylamino)ethoxy]ethyl}-5-methyluridine (CHEBI:39913) has functional parent uridine (CHEBI:16704) |
| nikkomycin Z (CHEBI:623918) has functional parent uridine (CHEBI:16704) |
| uridine-5'-carboxamide (CHEBI:195554) has functional parent uridine (CHEBI:16704) |
| uridine residue (CHEBI:73747) is substituent group from uridine (CHEBI:16704) |
| IUPAC Name |
|---|
| uridine |
| Synonyms | Source |
|---|---|
| 1-.beta.-d-ribofuranosyluracil | ChEMBL |
| 1-β-D-ribofuranosylpyrimidine-2,4(1H,3H)-dione | ChEBI |
| 1-β-D-ribofuranosyluracil | HMDB |
| NSC-20256 | ChEMBL |
| u | ChEBI |
| Uracil riboside | ChEMBL |
| UniProt Name | Source |
|---|---|
| uridine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00019674 | KNApSAcK |
| C00299 | KEGG COMPOUND |
| DB02745 | DrugBank |
| ECMDB00296 | ECMDB |
| HMDB0000296 | HMDB |
| URI | PDBeChem |
| Uridine | Wikipedia |
| URIDINE | MetaCyc |
| YMDB00127 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:397474 | Gmelin |
| Reaxys:754904 | Reaxys |
| CAS:58-96-8 | ChemIDplus |
| CAS:58-96-8 | KEGG COMPOUND |
| Citations |
|---|