EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O4 |
| Net Charge | 0 |
| Average Mass | 448.688 |
| Monoisotopic Mass | 448.35526 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])C[C@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H48O4/c1-15(2)16(3)25(31)26(32)17(4)20-7-8-21-19-14-24(30)23-13-18(29)9-11-28(23,6)22(19)10-12-27(20,21)5/h15-23,25-26,29,31-32H,7-14H2,1-6H3/t16-,17-,18+,19-,20+,21-,22-,23+,25+,26+,27+,28+/m0/s1 |
| InChIKey | SBSXXCCMIWEPEE-SELDZKRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica juncea (ncbitaxon:3707) | - | PubMed (25700090) | |
| Oryza sativa (ncbitaxon:4530) | seed (BTO:0001226) | PubMed (25433632) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| typhasterol (CHEBI:27173) has parent hydride 5α-campestane (CHEBI:20640) |
| typhasterol (CHEBI:27173) has role plant metabolite (CHEBI:76924) |
| typhasterol (CHEBI:27173) is a 22-hydroxy steroid (CHEBI:36863) |
| typhasterol (CHEBI:27173) is a 23-hydroxy steroid (CHEBI:36866) |
| typhasterol (CHEBI:27173) is a 3α-sterol (CHEBI:35347) |
| typhasterol (CHEBI:27173) is a 6-oxo steroid (CHEBI:36883) |
| typhasterol (CHEBI:27173) is a brassinosteroid (CHEBI:22921) |
| typhasterol (CHEBI:27173) is a C28-steroid (CHEBI:188921) |
| Incoming Relation(s) |
| 6-deoxotyphasterol (CHEBI:20717) has functional parent typhasterol (CHEBI:27173) |
| IUPAC Name |
|---|
| (3α,5α,22R,23R,24S)-3,22,23-trihydroxyergostan-6-one |
| Synonym | Source |
|---|---|
| 2-Deoxycastasterone | HMDB |
| UniProt Name | Source |
|---|---|
| typhasterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000185 | KNApSAcK |
| C15793 | KEGG COMPOUND |
| HMDB0034423 | HMDB |
| CPD-719 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3629989 | Reaxys |
| CAS:87734-68-7 | KNApSAcK |
| Citations |
|---|